![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1 Marianne/ | 2004-10-25 04:25 | - | |
| 2 Linh/ | 2004-10-24 11:04 | - | |
| 3 Mariann/ | 2004-10-24 01:09 | - | |
| BI 2014 The molecular basis of mad-cow disease/ | 2004-10-30 23:35 | - | |
| Bilder/ | 2004-10-23 16:58 | - | |
| EuroBRAIN%209%20Anglais.pdf | 2004-10-24 10:59 | 150K | |
| Presentation2.ppt | 2004-10-22 02:36 | 124K | |
| Prionv11.ppt | 2004-10-22 00:54 | 624K | |
| diverse.doc | 2004-10-16 23:34 | 685K | |
| forslag_innledning.doc | 2004-10-05 21:36 | 21K | |
| marianne.doc | 2004-10-11 00:14 | 1.0M | |
| view.doc | 2004-10-05 21:35 | 2.0M | |